2,4-Pyrimidinediamine,N4-butyl-6-chloro-5-[2-(4-chlorophenyl)diazenyl]- structure
|
Common Name | 2,4-Pyrimidinediamine,N4-butyl-6-chloro-5-[2-(4-chlorophenyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 92298-20-9 | Molecular Weight | 339.22300 | |
| Density | 1.41g/cm3 | Boiling Point | 587ºC at 760 mmHg | |
| Molecular Formula | C14H16Cl2N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.8ºC | |
| Name | 6-Chlor-2-amino-4-aethylamino-5-<4-chlor-benzolazo>-pyrimidin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 587ºC at 760 mmHg |
| Molecular Formula | C14H16Cl2N6 |
| Molecular Weight | 339.22300 |
| Flash Point | 308.8ºC |
| Exact Mass | 338.08100 |
| PSA | 88.55000 |
| LogP | 5.64720 |
| Index of Refraction | 1.659 |
| InChIKey | VAKCXRYHWPKWFC-UHFFFAOYSA-N |
| SMILES | CCCCNc1nc(N)nc(Cl)c1N=Nc1ccc(Cl)cc1 |
|
~%
2,4-Pyrimidined... CAS#:92298-20-9 |
| Literature: Reitz; Goodman; Pope; Argentieri; Bell; Burr; Chourmouzis; Come; Klaubert; Maryanoff; McDonnell; Rampulla; Schott; Chen Journal of Medicinal Chemistry, 1994 , vol. 37, # 21 p. 3561 - 3578 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N4-butyl-6-chloro-5-(4-chloro-phenylazo)-pyrimidine-2,4-diamine |
| 6-Chlor-2-<chinolyl-(2)>-chromon |
| 6-Chlor-2-amino-4-butylamino-5-<4-chlor-benzolazo>-pyrimidin |
| 6-Chlor-2-(2-chinolyl)chromon |
| 6-chloro-2-(quinolin-2-yl)-4h-chromen-4-one |
| 6-chloro-2-quinolin-2-yl-chromen-4-one |
| 6-chloro-5-(4-chloro-phenylazo)-N4-ethyl-pyrimidine-2,4-diamine |