N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide
Modify Date: 2025-09-25 21:46:14
![N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide Structure](https://www.chemsrc.com/extcaspic/218/923113-92-2.png)
N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide structure
|
Common Name | N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 923113-92-2 | Molecular Weight | 321.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H23NO5 |
|---|---|
| Molecular Weight | 321.4 |
| InChIKey | GAOIYGITSLDWCC-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1C(=O)NCC1COC2(CCCC2)O1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide? |
| A: Molecular weight of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide is 321.4. |
| Q: What is the English name of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide? |
| A: The English name of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide is N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide. |
| Q: What is the InChIKey of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide? |
| A: InChIKey of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide is GAOIYGITSLDWCC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide? |
| A: Molecular formula of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide is C17H23NO5. |
| Q: What is the SMILES notation of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide? |
| A: SMILES notation of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide is COc1cccc(OC)c1C(=O)NCC1COC2(CCCC2)O1. |
| Q: What is the CAS number of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide? |
| A: CAS number of N-(1,4-dioxaspiro[4.4]nonan-2-ylmethyl)-2,6-dimethoxybenzamide is 923113-92-2. |
| Q: What is the Chinese name of 923113-92-2? |
| A: Chinese name of 923113-92-2 is 923113-92-2. |