ethyl 2-((7-phenyl-6,7-dihydro-5H-imidazo[2,1-c][1,2,4]triazol-3-yl)thio)propanoate
Modify Date: 2025-11-23 11:08:59
![ethyl 2-((7-phenyl-6,7-dihydro-5H-imidazo[2,1-c][1,2,4]triazol-3-yl)thio)propanoate Structure](https://www.chemsrc.com/extcaspic/288/923194-98-3.png)
ethyl 2-((7-phenyl-6,7-dihydro-5H-imidazo[2,1-c][1,2,4]triazol-3-yl)thio)propanoate structure
|
Common Name | ethyl 2-((7-phenyl-6,7-dihydro-5H-imidazo[2,1-c][1,2,4]triazol-3-yl)thio)propanoate | ||
|---|---|---|---|---|
| CAS Number | 923194-98-3 | Molecular Weight | 318.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-((7-phenyl-6,7-dihydro-5H-imidazo[2,1-c][1,2,4]triazol-3-yl)thio)propanoate |
|---|
| Molecular Formula | C15H18N4O2S |
|---|---|
| Molecular Weight | 318.4 |
| InChIKey | FVPFMCDQGXKGQF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Sc1nnc2n1CCN2c1ccccc1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1