4-cyclopropyl-5-morpholin-4-yl-4H-1,2,4-triazole-3-thiol structure
|
Common Name | 4-cyclopropyl-5-morpholin-4-yl-4H-1,2,4-triazole-3-thiol | ||
|---|---|---|---|---|
| CAS Number | 923237-40-5 | Molecular Weight | 226.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-cyclopropyl-5-morpholin-4-yl-4H-1,2,4-triazole-3-thiol |
|---|
| Molecular Formula | C9H14N4OS |
|---|---|
| Molecular Weight | 226.30 |
| InChIKey | DKVLZBQFDDRIOK-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(N2CCOCC2)n1C1CC1 |
|
Name: Phenotypic Assay to Identify Small Molecules that Upregulate Production of hCFTR in H...
Source: Southern Research Institute
Target: CFTR
External Id: CF Folding
|