3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione
Modify Date: 2026-08-05 17:30:10
![3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione Structure](https://www.chemsrc.com/extcaspic/257/923461-16-9.png)
3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione structure
|
Common Name | 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione | ||
|---|---|---|---|---|
| CAS Number | 923461-16-9 | Molecular Weight | 337.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H19N5O2 |
|---|---|
| Molecular Weight | 337.4 |
| InChIKey | WGFAFDKZUJBAGJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(Cn2c(=O)c3c(nc4[nH]c(C)cn43)n(C)c2=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione? |
| A: SMILES notation of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione is Cc1ccc(C)c(Cn2c(=O)c3c(nc4[nH]c(C)cn43)n(C)c2=O)c1. |
| Q: What is the CAS number of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione? |
| A: CAS number of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione is 923461-16-9. |
| Q: What is the molecular weight of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione? |
| A: Molecular weight of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione is 337.4. |
| Q: What is the English name of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione? |
| A: The English name of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione is 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione. |
| Q: What is the InChIKey of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione? |
| A: InChIKey of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione is WGFAFDKZUJBAGJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione? |
| A: Molecular formula of 3-(2,5-dimethylbenzyl)-1,7-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione is C18H19N5O2. |
| Q: What is the Chinese name of 923461-16-9? |
| A: Chinese name of 923461-16-9 is 923461-16-9. |