Carbonic acid, thio-,O-ethyl S-purin-8-yl ester (7CI) structure
|
Common Name | Carbonic acid, thio-,O-ethyl S-purin-8-yl ester (7CI) | ||
|---|---|---|---|---|
| CAS Number | 92352-21-1 | Molecular Weight | 224.24000 | |
| Density | 1.5g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C8H8N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | ethyl 7H-purin-8-ylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.24000 |
| Flash Point | 208.9ºC |
| Exact Mass | 224.03700 |
| PSA | 106.06000 |
| LogP | 1.60150 |
| Index of Refraction | 1.665 |
| InChIKey | RQWFOULHPGOMPM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Sc1nc2ncncc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| thiocarbonic acid O-ethyl ester S-(7(9)H-purin-8-yl) ester |
| 8-Ethoxycarbonylmercapto-purin |
| HMS3086C23 |
| Purin-8-thiol-ethylcarbonat |