2-[(2-iodophenoxy)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolane structure
|
Common Name | 2-[(2-iodophenoxy)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 923594-96-1 | Molecular Weight | 450.19100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14F3IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-iodophenoxy)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolane |
|---|
| Molecular Formula | C17H14F3IO3 |
|---|---|
| Molecular Weight | 450.19100 |
| Exact Mass | 449.99400 |
| PSA | 27.69000 |
| LogP | 4.58860 |
| InChIKey | YAGVXMDVBPOUNA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(C2(COc3ccccc3I)OCCO2)cc1 |
|
~%
2-[(2-iodopheno... CAS#:923594-96-1 |
| Literature: Liu, Guixia; Lu, Xiyan Journal of the American Chemical Society, 2006 , vol. 128, # 51 p. 16504 - 16505 |
|
~%
2-[(2-iodopheno... CAS#:923594-96-1 |
| Literature: Liu, Guixia; Lu, Xiyan Journal of the American Chemical Society, 2006 , vol. 128, # 51 p. 16504 - 16505 |