1,3,5-Hexanetricarboxylicacid, 6-(ethylthio)-, 1,3,5-trimethyl ester structure
|
Common Name | 1,3,5-Hexanetricarboxylicacid, 6-(ethylthio)-, 1,3,5-trimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 92372-00-4 | Molecular Weight | 320.40200 | |
| Density | 1.125g/cm3 | Boiling Point | 382.6ºC at 760mmHg | |
| Molecular Formula | C14H24O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.2ºC | |
| Name | trimethyl 6-ethylsulfanylhexane-1,3,5-tricarboxylate |
|---|
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760mmHg |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.40200 |
| Flash Point | 171.2ºC |
| Exact Mass | 320.12900 |
| PSA | 104.20000 |
| LogP | 1.66120 |
| Index of Refraction | 1.474 |
| InChIKey | SWKZXBYXUDCATA-UHFFFAOYSA-N |
| SMILES | CCSCC(CC(CCC(=O)OC)C(=O)OC)C(=O)OC |
|
~%
1,3,5-Hexanetri... CAS#:92372-00-4 |
| Literature: Scott,G.P. et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 83 - 86 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |