Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt
Modify Date: 2025-09-17 16:10:12
Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt structure
|
Common Name | Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt | ||
|---|---|---|---|---|
| CAS Number | 92384-28-6 | Molecular Weight | 174.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H18N2O2 |
|---|---|
| Molecular Weight | 174.24 |
| InChIKey | KDYFNRIFGJQOLA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)[O-])[N+](C)(C)N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt? |
| A: The English name of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt is Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt. |
| Q: What is the CAS number of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt? |
| A: CAS number of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt is 92384-28-6. |
| Q: What is the SMILES notation of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt? |
| A: SMILES notation of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt is CC(C)CC(C(=O)[O-])[N+](C)(C)N. |
| Q: What is the molecular weight of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt? |
| A: Molecular weight of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt is 174.24. |
| Q: What is the Chinese name of 92384-28-6? |
| A: Chinese name of 92384-28-6 is 92384-28-6. |
| Q: What is the molecular formula of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt? |
| A: Molecular formula of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt is C8H18N2O2. |
| Q: What is the InChIKey of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt? |
| A: InChIKey of Hydrazinium, 1-(1-carboxy-3-methylbutyl)-1,1-dimethyl-, inner salt is KDYFNRIFGJQOLA-UHFFFAOYSA-N. |