Carbonic acid, trithio-, diester with 2-mercaptopropionic acid, (±) structure
|
Common Name | Carbonic acid, trithio-, diester with 2-mercaptopropionic acid, (±) | ||
|---|---|---|---|---|
| CAS Number | 924-57-2 | Molecular Weight | 254.34700 | |
| Density | 1.522±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 504.4±43.0 °C (760 mmHg) | |
| Molecular Formula | C7H10O4S3 | Melting Point | 153-154 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Carbonic acid, trithio-, diester with 2-mercaptopropionic acid, (±) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 504.4±43.0 °C (760 mmHg) |
| Melting Point | 153-154 °C |
| Molecular Formula | C7H10O4S3 |
| Molecular Weight | 254.34700 |
| Exact Mass | 253.97400 |
| PSA | 157.29000 |
| LogP | 1.68390 |
| InChIKey | WJSJKNCWBHCYME-QWWZWVQMSA-N |
| SMILES | CC(SC(=S)SC(C)C(=O)O)C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| Propionic acid, 2-mercapto-, trithiocarbonate (2:1), (±)- |