2,7-dimethyl-2H-pyrano[4,3-b]pyran-5-one structure
|
Common Name | 2,7-dimethyl-2H-pyrano[4,3-b]pyran-5-one | ||
|---|---|---|---|---|
| CAS Number | 92405-72-6 | Molecular Weight | 178.18500 | |
| Density | 1.218g/cm3 | Boiling Point | 331.1ºC at 760 mmHg | |
| Molecular Formula | C10H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.583ºC | |
| Name | 2,7-dimethyl-2H-pyrano[4,3-b]pyran-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 331.1ºC at 760 mmHg |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18500 |
| Flash Point | 136.583ºC |
| Exact Mass | 178.06300 |
| PSA | 39.44000 |
| LogP | 1.74230 |
| Index of Refraction | 1.554 |
| InChIKey | ZNMBPOUUWQQGDL-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(c(=O)o1)C=CC(C)O2 |
| HS Code | 2932999099 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-DIMETHYLCYCLOHEXANONE |
| 2,7-dimethyl-2H,5H-pyrano<3,2-c>pyran-5-one |