2,6-ditert-butylpyridine-3-sulfonic acid structure
|
Common Name | 2,6-ditert-butylpyridine-3-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 92423-50-2 | Molecular Weight | 271.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butylpyridine-3-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H21NO3S |
|---|---|
| Molecular Weight | 271.37600 |
| Exact Mass | 271.12400 |
| PSA | 75.64000 |
| LogP | 4.00410 |
| InChIKey | ALIOSIQUHNKJSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)O)c(C(C)(C)C)n1 |
|
~%
2,6-ditert-buty... CAS#:92423-50-2 |
| Literature: Brown; Kanner Journal of the American Chemical Society, 1953 , vol. 75, p. 3865 |
|
~%
2,6-ditert-buty... CAS#:92423-50-2 |
| Literature: Brown; Kanner Journal of the American Chemical Society, 1953 , vol. 75, p. 3865 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-Di-tert-butyl-pyridin-3-sulfonsaeure |
| 2,6-di-tert-butyl-pyridine-3-sulfonic acid |
| 2,6-Di-tert.-butyl-pyridin-sulfonsaeure-(3) |