1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione
Modify Date: 2026-08-21 21:55:16
1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione structure
|
Common Name | 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione | ||
|---|---|---|---|---|
| CAS Number | 92425-12-2 | Molecular Weight | 332.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10BrNO3 |
|---|---|
| Molecular Weight | 332.15 |
| InChIKey | YTWMAWOUKMMCEQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c2c(c1N)C(=O)c1cccc(O)c1C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione? |
| A: InChIKey of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione is YTWMAWOUKMMCEQ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione? |
| A: The English name of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione is 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione. |
| Q: What is the molecular weight of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione? |
| A: Molecular weight of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione is 332.15. |
| Q: What is the SMILES notation of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione? |
| A: SMILES notation of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione is Cc1cc(Br)c2c(c1N)C(=O)c1cccc(O)c1C2=O. |
| Q: What is the Chinese name of 92425-12-2? |
| A: Chinese name of 92425-12-2 is 92425-12-2. |
| Q: What is the CAS number of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione? |
| A: CAS number of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione is 92425-12-2. |
| Q: What is the molecular formula of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione? |
| A: Molecular formula of 1-Amino-4-bromo-5-hydroxy-2-methyl-9,10-anthracenedione is C15H10BrNO3. |