(1S,3aS,3bR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one structure
|
Common Name | (1S,3aS,3bR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one | ||
|---|---|---|---|---|
| CAS Number | 92472-37-2 | Molecular Weight | 303.43900 | |
| Density | 1.15g/cm3 | Boiling Point | 467.6ºC at 760 mmHg | |
| Molecular Formula | C19H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.6ºC | |
| Name | (1S,3aS,3bR,9aR,9bS,11aS)-1-hydroxy-6,9a,11a-trimethyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 467.6ºC at 760 mmHg |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.43900 |
| Flash Point | 236.6ºC |
| Exact Mass | 303.22000 |
| PSA | 40.54000 |
| LogP | 3.27380 |
| Index of Refraction | 1.574 |
| InChIKey | MICZNRRTCUCNTP-BMSLSITRSA-N |
| SMILES | CN1C(=O)CCC2(C)C1=CCC1C2CCC2(C)C(O)CCC12 |
|
~%
(1S,3aS,3bR,9aR... CAS#:92472-37-2 |
| Literature: Dalmases; Cervantes; Quintana; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 5 p. 465 - 467 |
|
~%
(1S,3aS,3bR,9aR... CAS#:92472-37-2 |
| Literature: Rasmusson, Gary H.; Reynolds, Glenn F.; Utne, Torleif; Jobson, Ronald B.; Primka, Raymond L.; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1690 - 1701 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Oestrenolon |
| nortestosterone |
| NADROLONE |
| NANDROLON |
| Nandrolone Base |
| 19-nortestosterone |
| 17beta-hydroxy-4-estren-3-one |
| menidrabol |
| nortestonate |