Methyl 1-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate
Modify Date: 2025-09-21 17:31:07
Methyl 1-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate structure
|
Common Name | Methyl 1-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 92473-55-7 | Molecular Weight | 234.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-methyl-2,3-dioxo-4H-quinoxaline-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2O4 |
|---|---|
| Molecular Weight | 234.20800 |
| Exact Mass | 234.06400 |
| PSA | 81.16000 |
| LogP | 0.01340 |
| InChIKey | IBTGJUQDPCIFIA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c(=O)c(=O)n2C |
| HS Code | 2933990090 |
|---|
|
~%
Methyl 1-methyl... CAS#:92473-55-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 28, # 3 p. 363 - 366 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![7-chloro-5-propyl-2H-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dione structure](https://image.chemsrc.com/caspic/349/80708-33-4.png)
CAS#:80708-33-4| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HE-0728 |
| methyl 1-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate |