3',4'-Dichloro-2-biphenylcarbaldehyde structure
|
Common Name | 3',4'-Dichloro-2-biphenylcarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 924868-83-7 | Molecular Weight | 251.10800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3',4'-Dichloro-2-biphenylcarbaldehyde |
|---|
| Molecular Formula | C13H8Cl2O |
|---|---|
| Molecular Weight | 251.10800 |
| Exact Mass | 249.99500 |
| PSA | 17.07000 |
| LogP | 4.47290 |
| InChIKey | CMBZZYKUZBAYQD-UHFFFAOYSA-N |
| SMILES | O=Cc1ccccc1-c1ccc(Cl)c(Cl)c1 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |