1,4-Bis(2-oxopropyl) butanedioate
Modify Date: 2026-07-04 13:26:20
1,4-Bis(2-oxopropyl) butanedioate structure
|
Common Name | 1,4-Bis(2-oxopropyl) butanedioate | ||
|---|---|---|---|---|
| CAS Number | 925-07-5 | Molecular Weight | 230.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Bis(2-oxopropyl) butanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14O6 |
|---|---|
| Molecular Weight | 230.21 |
| InChIKey | UBZJWSDVSJMFMY-UHFFFAOYSA-N |
| SMILES | CC(=O)COC(=O)CCC(=O)OCC(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-Bis(2-oxopropyl) butanedioate? |
| A: The English name of 1,4-Bis(2-oxopropyl) butanedioate is 1,4-Bis(2-oxopropyl) butanedioate. |
| Q: What is the SMILES notation of 1,4-Bis(2-oxopropyl) butanedioate? |
| A: SMILES notation of 1,4-Bis(2-oxopropyl) butanedioate is CC(=O)COC(=O)CCC(=O)OCC(C)=O. |
| Q: What is the InChIKey of 1,4-Bis(2-oxopropyl) butanedioate? |
| A: InChIKey of 1,4-Bis(2-oxopropyl) butanedioate is UBZJWSDVSJMFMY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,4-Bis(2-oxopropyl) butanedioate? |
| A: CAS number of 1,4-Bis(2-oxopropyl) butanedioate is 925-07-5. |
| Q: What is the molecular weight of 1,4-Bis(2-oxopropyl) butanedioate? |
| A: Molecular weight of 1,4-Bis(2-oxopropyl) butanedioate is 230.21. |
| Q: What is the molecular formula of 1,4-Bis(2-oxopropyl) butanedioate? |
| A: Molecular formula of 1,4-Bis(2-oxopropyl) butanedioate is C10H14O6. |
| Q: What is the Chinese name of 925-07-5? |
| A: Chinese name of 925-07-5 is 925-07-5. |