3-hydroxy-5-methyl-3-phenyl-1-benzofuran-2-one structure
|
Common Name | 3-hydroxy-5-methyl-3-phenyl-1-benzofuran-2-one | ||
|---|---|---|---|---|
| CAS Number | 92545-53-4 | Molecular Weight | 240.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-5-methyl-3-phenyl-1-benzofuran-2-one |
|---|
| Molecular Formula | C15H12O3 |
|---|---|
| Molecular Weight | 240.25400 |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 2.14990 |
| InChIKey | BHVGUJDNUAYZGN-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(O)(c1ccccc1)C(=O)O2 |
|
~24%
3-hydroxy-5-met... CAS#:92545-53-4 |
| Literature: Lohray, B. B.; Kumar, C. V.; Das, P. K.; George, M. V. Journal of the American Chemical Society, 1984 , vol. 106, # 24 p. 7352 - 7359 |
|
~24%
3-hydroxy-5-met... CAS#:92545-53-4 |
| Literature: Lohray, B. B.; Kumar, C. V.; Das, P. K.; George, M. V. Journal of the American Chemical Society, 1984 , vol. 106, # 24 p. 7352 - 7359 |