1,1'-Biphenyl,4-methyl-3-(2,2,2-trichloroethyl)
1,1'-Biphenyl,4-methyl-3-(2,2,2-trichloroethyl) structure
|
Common Name | 1,1'-Biphenyl,4-methyl-3-(2,2,2-trichloroethyl) | ||
|---|---|---|---|---|
| CAS Number | 92551-75-2 | Molecular Weight | 299.62300 | |
| Density | 1.258g/cm3 | Boiling Point | 386.4ºC at 760mmHg | |
| Molecular Formula | C15H13Cl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 386.4ºC at 760mmHg |
| Molecular Formula | C15H13Cl3 |
| Molecular Weight | 299.62300 |
| Flash Point | 270.6ºC |
| Exact Mass | 298.00800 |
| LogP | 5.57470 |
| Index of Refraction | 1.584 |
| InChIKey | BLNVDSQUOQLRFS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccccc2)cc1CC(Cl)(Cl)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![[1,1'-Biphenyl]-3,4-dicarboxylicacid structure](https://image.chemsrc.com/caspic/429/4445-58-3.png)
CAS#:4445-58-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: LogP of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is 5.57470. |
| Q: What are the downstream products of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: Related downstream products(CAS) of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene: 4445-58-3. |
| Q: What is the molecular weight of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: Molecular weight of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is 299.62300. |
| Q: What is the InChIKey of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: InChIKey of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is BLNVDSQUOQLRFS-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: Boiling point of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is 386.4ºC at 760mmHg. |
| Q: What is the SMILES notation of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: SMILES notation of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is Cc1ccc(-c2ccccc2)cc1CC(Cl)(Cl)Cl. |
| Q: What is the Chinese name of 92551-75-2? |
| A: Chinese name of 92551-75-2 is 92551-75-2. |
| Q: What is the molecular formula of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: Molecular formula of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is C15H13Cl3. |
| Q: What is the CAS number of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: CAS number of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is 92551-75-2. |
| Q: What is the English name of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene? |
| A: The English name of 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene is 1-methyl-4-phenyl-2-(2,2,2-trichloroethyl)benzene. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |