N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide
Modify Date: 2026-08-14 19:33:35
N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide structure
|
Common Name | N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 925552-29-0 | Molecular Weight | 274.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10N2OS2 |
|---|---|
| Molecular Weight | 274.4 |
| InChIKey | JHPSORUXNQTLEW-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(NC(=O)c3ccsc3)sc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide? |
| A: CAS number of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide is 925552-29-0. |
| Q: What is the English name of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide? |
| A: The English name of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide is N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide. |
| Q: What is the Chinese name of 925552-29-0? |
| A: Chinese name of 925552-29-0 is 925552-29-0. |
| Q: What is the SMILES notation of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide? |
| A: SMILES notation of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide is Cc1ccc2nc(NC(=O)c3ccsc3)sc2c1. |
| Q: What is the molecular formula of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide? |
| A: Molecular formula of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide is C13H10N2OS2. |
| Q: What is the InChIKey of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide? |
| A: InChIKey of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide is JHPSORUXNQTLEW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide? |
| A: Molecular weight of N-(6-methyl-1,3-benzothiazol-2-yl)thiophene-3-carboxamide is 274.4. |