KU-60019 structure
|
Common Name | KU-60019 | ||
|---|---|---|---|---|
| CAS Number | 925701-49-1 | Molecular Weight | 547.665 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 786.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C30H33N3O5S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 429.5±32.9 °C | |
| Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[5-(6-morpholin-4-yl-4-oxopyran-2-yl)-9H-thioxanthen-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 786.6±60.0 °C at 760 mmHg |
| Molecular Formula | C30H33N3O5S |
| Molecular Weight | 547.665 |
| Flash Point | 429.5±32.9 °C |
| Exact Mass | 547.214111 |
| PSA | 109.55000 |
| LogP | 5.90 |
| Appearance of Characters | light yellow solid |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | SCELLOWTHJGVIC-BGYRXZFFSA-N |
| SMILES | CC1CN(CC(=O)Nc2ccc3c(c2)Cc2cccc(-c4cc(=O)cc(N5CCOCC5)o4)c2S3)CC(C)O1 |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|
| 2-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-N-{5-[6-(4-morpholinyl)-4-oxo-4H-pyran-2-yl]-9H-thioxanthen-2-yl}acetamide |
| cc-509 |
| CS-0221 |
| 4-Morpholineacetamide, 2,6-dimethyl-N-[5-[6-(4-morpholinyl)-4-oxo-4H-pyran-2-yl]-9H-thioxanthen-2-yl]-, (2R,6S)- |
| S1570_Selleck |
| KU-60019 |