3-hydroxy-1-phenylundecan-1-one structure
|
Common Name | 3-hydroxy-1-phenylundecan-1-one | ||
|---|---|---|---|---|
| CAS Number | 92573-01-8 | Molecular Weight | 262.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-1-phenylundecan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O2 |
|---|---|
| Molecular Weight | 262.38700 |
| Exact Mass | 262.19300 |
| PSA | 37.30000 |
| LogP | 4.37090 |
| InChIKey | SVEMKPLOJJOELY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(O)CC(=O)c1ccccc1 |
|
~73%
3-hydroxy-1-phe... CAS#:92573-01-8 |
| Literature: Tsuboniwa, Noriyuki; Matsubara, Seijiro; Morizawa, Yoshitomi; Oshima, Koichiro; Nozaki, Hitosi Tetrahedron Letters, 1984 , vol. 25, # 24 p. 2569 - 2572 |
|
~79%
3-hydroxy-1-phe... CAS#:92573-01-8 |
| Literature: Matsubara; Tsuboniwa; Morizawa; Oshima; Nozaki Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 11 p. 3242 - 3246 |
|
~78%
3-hydroxy-1-phe... CAS#:92573-01-8 |
| Literature: Shen, Zhen; Zhang, Jinqi; Zou, Huixian; Yang, Minmin Tetrahedron Letters, 1997 , vol. 38, # 15 p. 2733 - 2736 |
| 3-hydroxy-1-phenyl-1-undecanone |
| 1-Undecanone,3-hydroxy-1-phenyl |