Di(3,5,5-triMethylhexyl)amine structure
|
Common Name | Di(3,5,5-triMethylhexyl)amine | ||
|---|---|---|---|---|
| CAS Number | 926-75-0 | Molecular Weight | 269.50900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H39N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H39N |
|---|---|
| Molecular Weight | 269.50900 |
| Exact Mass | 269.30800 |
| PSA | 12.03000 |
| LogP | 5.89170 |
| InChIKey | SJRZFAAEEUWNDE-UHFFFAOYSA-N |
| SMILES | CC(CCNCCC(C)CC(C)(C)C)CC(C)(C)C |
|
~%
Di(3,5,5-triMet... CAS#:926-75-0 |
| Literature: Bacon,R.G.R.; Stewart,D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1384 - 1387 |
|
~%
Di(3,5,5-triMet... CAS#:926-75-0 |
| Literature: Bacon,R.G.R.; Stewart,D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1384 - 1387 |
| Diisononylamin |
| Di-<3,5,5-trimethyl-hexyl)-amin |