Di(3,5,5-triMethylhexyl)amine
Di(3,5,5-triMethylhexyl)amine structure
|
Common Name | Di(3,5,5-triMethylhexyl)amine | ||
|---|---|---|---|---|
| CAS Number | 926-75-0 | Molecular Weight | 269.50900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H39N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H39N |
|---|---|
| Molecular Weight | 269.50900 |
| Exact Mass | 269.30800 |
| PSA | 12.03000 |
| LogP | 5.89170 |
| InChIKey | SJRZFAAEEUWNDE-UHFFFAOYSA-N |
| SMILES | CC(CCNCCC(C)CC(C)(C)C)CC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Di(3,5,5-triMet... CAS#:926-75-0 |
| Literature: Bacon,R.G.R.; Stewart,D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1384 - 1387 |
|
~%
Di(3,5,5-triMet... CAS#:926-75-0 |
| Literature: Bacon,R.G.R.; Stewart,D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1384 - 1387 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diisononylamin |
| Di-<3,5,5-trimethyl-hexyl)-amin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 926-75-0? |
| A: Chinese name of 926-75-0 is 926-75-0. |
| Q: What is the SMILES notation of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: SMILES notation of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is CC(CCNCCC(C)CC(C)(C)C)CC(C)(C)C. |
| Q: What is the LogP of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: LogP of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is 5.89170. |
| Q: What is the CAS number of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: CAS number of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is 926-75-0. |
| Q: What is the English name of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: The English name of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine. |
| Q: What English synonyms does 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine have? |
| A: English synonyms of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine: Diisononylamin, Di-<3,5,5-trimethyl-hexyl)-amin. |
| Q: What is the molecular formula of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: Molecular formula of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is C18H39N. |
| Q: What is the molecular weight of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: Molecular weight of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is 269.50900. |
| Q: What is the InChIKey of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: InChIKey of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is SJRZFAAEEUWNDE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine? |
| A: Polar surface area (PSA) of 3,5,5-trimethyl-N-(3,5,5-trimethylhexyl)hexan-1-amine is 12.03000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |