H-Ala-Ala-Ala-Ala-OH structure
|
Common Name | H-Ala-Ala-Ala-Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 926-79-4 | Molecular Weight | 302.33 | |
| Density | 1.237g/cm3 | Boiling Point | 703.1ºC at 760mmHg | |
| Molecular Formula | C12H22N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379ºC | |
Use of H-Ala-Ala-Ala-Ala-OHAla-Ala-Ala-Ala is a poly-L-alanine (PLA) sequences. PLA is a kind of key element of the crystalline domains of spider dragline and wild silkworm silks[1]. |
| Name | 2-[2-[2-(2-aminopropanoylamino)propanoylamino]propanoylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ala-Ala-Ala-Ala is a poly-L-alanine (PLA) sequences. PLA is a kind of key element of the crystalline domains of spider dragline and wild silkworm silks[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 703.1ºC at 760mmHg |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 |
| Flash Point | 379ºC |
| Exact Mass | 302.15900 |
| PSA | 150.62000 |
| Index of Refraction | 1.513 |
| InChIKey | ZHRZLXZJVUFLNY-XAMCCFCMSA-N |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)O |
| EINECS 213-145-1 |
| L-Alanine,N-[N-(N-L-alanyl-L-alanyl)-L-alanyl] |
| N-[2-((2-[(2-Aminopropanoyl)amino]propanoyl)amino)propanoyl]alanine |
| Ala-Ala-Ala-Ala |
| Alanyl-alanyl-alanyl-alanine |
| H-(L-Ala)4-OH |
| H-Ala-Ala-Ala-Ala-OH |