Dimethyl 2-hydroxy-2-phenylmalonate
Modify Date: 2026-07-01 19:49:13
Dimethyl 2-hydroxy-2-phenylmalonate structure
|
Common Name | Dimethyl 2-hydroxy-2-phenylmalonate | ||
|---|---|---|---|---|
| CAS Number | 92607-06-2 | Molecular Weight | 224.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl 2-hydroxy-2-phenylmalonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12O5 |
|---|---|
| Molecular Weight | 224.21 |
| InChIKey | YMGHNRDRCGBBJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)(C(=O)OC)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 92607-06-2? |
| A: Chinese name of 92607-06-2 is 92607-06-2. |
| Q: What is the English name of Dimethyl 2-hydroxy-2-phenylmalonate? |
| A: The English name of Dimethyl 2-hydroxy-2-phenylmalonate is Dimethyl 2-hydroxy-2-phenylmalonate. |
| Q: What is the InChIKey of Dimethyl 2-hydroxy-2-phenylmalonate? |
| A: InChIKey of Dimethyl 2-hydroxy-2-phenylmalonate is YMGHNRDRCGBBJK-UHFFFAOYSA-N. |
| Q: What is the CAS number of Dimethyl 2-hydroxy-2-phenylmalonate? |
| A: CAS number of Dimethyl 2-hydroxy-2-phenylmalonate is 92607-06-2. |
| Q: What is the molecular formula of Dimethyl 2-hydroxy-2-phenylmalonate? |
| A: Molecular formula of Dimethyl 2-hydroxy-2-phenylmalonate is C11H12O5. |
| Q: What is the molecular weight of Dimethyl 2-hydroxy-2-phenylmalonate? |
| A: Molecular weight of Dimethyl 2-hydroxy-2-phenylmalonate is 224.21. |
| Q: What is the SMILES notation of Dimethyl 2-hydroxy-2-phenylmalonate? |
| A: SMILES notation of Dimethyl 2-hydroxy-2-phenylmalonate is COC(=O)C(O)(C(=O)OC)c1ccccc1. |