(2-bromo-4,5-diethoxyphenyl)methylhydrazine,hydrochloride structure
|
Common Name | (2-bromo-4,5-diethoxyphenyl)methylhydrazine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 926199-79-3 | Molecular Weight | 325.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-bromo-4,5-diethoxyphenyl)methylhydrazine,hydrochloride |
|---|
| Molecular Formula | C11H18BrClN2O2 |
|---|---|
| Molecular Weight | 325.63000 |
| Exact Mass | 324.02400 |
| PSA | 56.51000 |
| LogP | 4.10300 |
| InChIKey | VRJNFMLVGAVASD-UHFFFAOYSA-N |
| SMILES | CCOc1cc(Br)c(CNN)cc1OCC.Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |