triethyl-(3-oxo-1H-2-benzofuran-1-yl)azanium,chloride structure
|
Common Name | triethyl-(3-oxo-1H-2-benzofuran-1-yl)azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 92641-11-7 | Molecular Weight | 269.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethyl-(3-oxo-1H-2-benzofuran-1-yl)azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20ClNO2 |
|---|---|
| Molecular Weight | 269.76700 |
| Exact Mass | 269.11800 |
| PSA | 26.30000 |
| InChIKey | GHXUBMGTACKBGX-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)C1OC(=O)c2ccccc21.[Cl-] |
|
~%
triethyl-(3-oxo... CAS#:92641-11-7 |
| Literature: Shionogi and Co., Ltd. Patent: US4605738 A1, 1986 ; |
|
~24%
triethyl-(3-oxo... CAS#:92641-11-7 |
| Literature: Kamata; Haga; Matsui; Nagata Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 8 p. 3160 - 3175 |
| 1-Isobenzofuranaminium,N,N,N-triethyl-1,3-dihydro-3-oxo-,chloride |
| N,N,N-triethyl-3-oxo-1,3-dihydro-1-isobenzofuranylammonium chloride |