2-[acetyl-(4-prop-2-enoxyphenyl)amino]-N,N-dimethyl-acetamide structure
|
Common Name | 2-[acetyl-(4-prop-2-enoxyphenyl)amino]-N,N-dimethyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 92648-68-5 | Molecular Weight | 276.33100 | |
| Density | 1.118g/cm3 | Boiling Point | 440.4ºC at 760mmHg | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | 2-(N-acetyl-4-prop-2-enoxyanilino)-N,N-dimethylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760mmHg |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.33100 |
| Flash Point | 220.2ºC |
| Exact Mass | 276.14700 |
| PSA | 49.85000 |
| LogP | 1.69250 |
| Index of Refraction | 1.548 |
| InChIKey | OTIFGIOJEKLAEI-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(N(CC(=O)N(C)C)C(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| gb-336 |