N-CBZ-NORTROPINE structure
|
Common Name | N-CBZ-NORTROPINE | ||
|---|---|---|---|---|
| CAS Number | 92652-76-1 | Molecular Weight | 261.316 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 416.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6±28.7 °C | |
| Name | n-cbz-nortropine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.4±45.0 °C at 760 mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.316 |
| Flash Point | 205.6±28.7 °C |
| Exact Mass | 261.136505 |
| PSA | 49.77000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | AXRYOOOSGBBQPJ-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1C2CCC1CC(O)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-CBZ-PSEUDOTROPINE |
| Benzyl 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| 3-Hydroxy-8-aza-bicyclo[3.2.1]octane-8-carboxylic acid benzyl ester |
| 8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-hydroxy-, phenylmethyl ester |
| 3-hydroxy-nortropane-8-carboxylic acid benzyl ester |
| 8-Azabicyclo[3.2.1]octane-8-carboxylic acid,3-hydroxy-,phenylMethyl ester |