CEFPROZIL (E)-ISOMER (50 MG)G0D341872UG/MG(AI) structure
|
Common Name | CEFPROZIL (E)-ISOMER (50 MG)G0D341872UG/MG(AI) | ||
|---|---|---|---|---|
| CAS Number | 92676-86-3 | Molecular Weight | 407.44100 | |
| Density | N/A | Boiling Point | 803.1ºC at 760mmHg | |
| Molecular Formula | C18H21N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 439.5ºC | |
| Name | (6R,7R)-7-{[(2R)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino}-8-oxo-3 -[(1Z)-1-propen-1-yl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbo xylic acid hydrate (1:1) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 803.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.44100 |
| Flash Point | 439.5ºC |
| Exact Mass | 407.11500 |
| PSA | 170.98000 |
| LogP | 2.12090 |
| InChIKey | WDLWHQDACQUCJR-ZAMMOSSLSA-N |
| SMILES | CC=CC1=C(C(=O)O)N2C(=O)C(NC(=O)C(N)c3ccc(O)cc3)C2SC1 |
|
~%
CEFPROZIL (E)-I... CAS#:92676-86-3 |
| Literature: CJ CORPORATION Patent: WO2005/42544 A1, 2005 ; Location in patent: Page/Page column 8 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Identifying Sarm1 Tir Hydrolase inhibitors through NAD-Glo assay
Source: 24386
Target: N/A
External Id: Sarm1 Tir NADase inhibitors screen
|
|
Name: ERK5 transcriptional activity HTS
Source: 24565
Target: N/A
External Id: ERK5 transcriptional activity-HTS
|
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Phenotypic Assay to Identify Small Molecules that Upregulate Production of hCFTR in H...
Source: Southern Research Institute
Target: CFTR
External Id: CF Folding
|
| 7-[2-amino-2-(4-hydroxyphenyl)acetamido]-3-[(E)-propen-1-yl]-3-cephem-4-carboxylic acid |
| (7R,8R)-7-[(R)-2-amino-2-(4-hydroxyphenyl)acetamido]-3-[(E)-propen-1-yl]-3-cephem-4-carboxylic acid |
| Acetic acid,(4-oxo-2-thiazolidinylidene)-,methyl ester,(E) |
| E-Carbomethoxymethylenthiazolidin-4-on |
| ((E)-4-oxo-thiazolidin-2-ylidene)-acetic acid methyl ester |
| E-cefprozil |
| trans-Cefprozil |