(2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate
Modify Date: 2025-10-14 16:01:40
(2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate structure
|
Common Name | (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 926859-62-3 | Molecular Weight | 319.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17NO4S |
|---|---|
| Molecular Weight | 319.4 |
| InChIKey | RDIRGBXPDDEADV-UHFFFAOYSA-N |
| SMILES | COc1cccc(COC(=O)c2cccnc2SC)c1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate? |
| A: Molecular formula of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate is C16H17NO4S. |
| Q: What is the Chinese name of 926859-62-3? |
| A: Chinese name of 926859-62-3 is 926859-62-3. |
| Q: What is the InChIKey of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate? |
| A: InChIKey of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate is RDIRGBXPDDEADV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate? |
| A: SMILES notation of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate is COc1cccc(COC(=O)c2cccnc2SC)c1OC. |
| Q: What is the molecular weight of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate? |
| A: Molecular weight of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate is 319.4. |
| Q: What is the English name of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate? |
| A: The English name of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate is (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate. |
| Q: What is the CAS number of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate? |
| A: CAS number of (2,3-Dimethoxyphenyl)methyl 2-(methylsulfanyl)pyridine-3-carboxylate is 926859-62-3. |