1,2-bis[4-(4-tert-butylphenoxy)phenyl]ethane-1,2-dione
Modify Date: 2024-01-05 11:14:04
![1,2-bis[4-(4-tert-butylphenoxy)phenyl]ethane-1,2-dione Structure](https://image.chemsrc.com/caspic/160/926896-66-4.png)
1,2-bis[4-(4-tert-butylphenoxy)phenyl]ethane-1,2-dione structure
|
Common Name | 1,2-bis[4-(4-tert-butylphenoxy)phenyl]ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 926896-66-4 | Molecular Weight | 506.63100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis[4-(4-tert-butylphenoxy)phenyl]ethane-1,2-dione |
|---|
| Molecular Formula | C34H34O4 |
|---|---|
| Molecular Weight | 506.63100 |
| Exact Mass | 506.24600 |
| PSA | 52.60000 |
| LogP | 8.93180 |
| InChIKey | LYWRHBPTVKILSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(=O)C(=O)c3ccc(Oc4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
|
~77%
1,2-bis[4-(4-te... CAS#:926896-66-4 |
| Literature: Park, Hyo Young; Lee, Junho; Park, Kihong; Kim, Jong-Man Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 2 p. 401 - 402 |
