17(S)-HDoHE structure
|
Common Name | 17(S)-HDoHE | ||
|---|---|---|---|---|
| CAS Number | 92693-03-3 | Molecular Weight | 344.488 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 505.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.4±26.6 °C | |
Use of 17(S)-HDoHE17(S)-HDHA is a hydroxy fatty acid formed from docosahexaenoic acid by 15-lipoxygenase (15-LO) and is a precursor to 17(S)-resolvins. |
| Name | (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-Hydroxy-4,7,10,13,15,19-docosahexa enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.1±50.0 °C at 760 mmHg |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.488 |
| Flash Point | 273.4±26.6 °C |
| Exact Mass | 344.235138 |
| PSA | 57.53000 |
| LogP | 5.32 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | SWTYBBUBEPPYCX-YTQNUIGOSA-N |
| SMILES | CCC=CCC(O)C=CC=CCC=CCC=CCC=CCCC(=O)O |
|
~%
17(S)-HDoHE CAS#:92693-03-3 |
| Literature: BRIGHAM AND WOMEN'S HOSPITAL Patent: WO2004/14835 A2, 2004 ; Location in patent: Page 101; 105 ; |
|
~%
17(S)-HDoHE CAS#:92693-03-3 |
| Literature: Kato, Tadahiro; Watanabe, Tsutomu; Hirukawa, Toshifumi; Tomita, Norihiro; Namai, Tsuneo Bulletin of the Chemical Society of Japan, 1996 , vol. 69, # 6 p. 1663 - 1666 |
| 4,7,10,13,15,19-Docosahexaenoic acid, 17-hydroxy-, (4Z,7Z,10Z,13Z,15E,17S,19Z)- |
| (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-Hydroxy-4,7,10,13,15,19-docosahexaenoic acid |
| 4,5-dehydro 17S-HDHA |
| 17S-hydroxy-4Z,7Z,10Z,13Z,15E,19Z-docosahexaenoic acid |