1,2-Cycloheptanedicarboxylicacid, 3-(4-morpholinyl)-, 1,2-dimethyl ester structure
|
Common Name | 1,2-Cycloheptanedicarboxylicacid, 3-(4-morpholinyl)-, 1,2-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 92703-13-4 | Molecular Weight | 295.33100 | |
| Density | 1.219g/cm3 | Boiling Point | 410.9ºC at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | dimethyl 3-morpholin-4-ylcyclohepta-2,7-diene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 410.9ºC at 760 mmHg |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33100 |
| Flash Point | 202.3ºC |
| Exact Mass | 295.14200 |
| PSA | 65.07000 |
| LogP | 0.96690 |
| Index of Refraction | 1.531 |
| InChIKey | NEGJKRWHSNMMAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CCCCC(N2CCOCC2)=C1C(=O)OC |
|
~63%
1,2-Cycloheptan... CAS#:92703-13-4 |
| Literature: Miesch, Michel; Wendling, Florence European Journal of Organic Chemistry, 2000 , # 20 p. 3381 - 3392 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-morpholin-4-yl-cyclohepta-2,7-diene-1,2-dicarboxylic acid dimethyl ester |
| 1-Morpholino-2,3-dicarbomethoxy-1,3-cycloheptadien |