[3-(2-hydroxy-4-methoxyphenyl)-3-oxo-2-phenylpropyl] acetate structure
|
Common Name | [3-(2-hydroxy-4-methoxyphenyl)-3-oxo-2-phenylpropyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 92714-95-9 | Molecular Weight | 314.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(2-hydroxy-4-methoxyphenyl)-3-oxo-2-phenylpropyl] acetate |
|---|
| Molecular Formula | C18H18O5 |
|---|---|
| Molecular Weight | 314.33300 |
| Exact Mass | 314.11500 |
| PSA | 72.83000 |
| LogP | 2.93040 |
| InChIKey | RPGPOSBDORAKJT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(COC(C)=O)c2ccccc2)c(O)c1 |
|
~71%
[3-(2-hydroxy-4... CAS#:92714-95-9 |
| Literature: Parmar, Virinder S.; Prasad, Ashok K.; Pati, Hari N.; Kumar, Rajesh; Azim, Abul; Roy, Sucharita; Errington, William Bioorganic Chemistry, 1999 , vol. 27, # 2 p. 119 - 134 |
|
~%
[3-(2-hydroxy-4... CAS#:92714-95-9 |
| Literature: Jain, Amolak C.; Mehta, Anita Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 215 - 220 |
|
~62%
[3-(2-hydroxy-4... CAS#:92714-95-9 |
| Literature: Jain, Amolak C.; Mehta, Anita Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 215 - 220 |