α-Piperidinobutiophenone hydrochloride (α-PipBP) structure
|
Common Name | α-Piperidinobutiophenone hydrochloride (α-PipBP) | ||
|---|---|---|---|---|
| CAS Number | 92728-82-0 | Molecular Weight | 267.794 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of α-Piperidinobutiophenone hydrochloride (α-PipBP)α-Piperidinobutiophenone is an analog of MPBP that lacks the 4-methyl group. |
| Name | 1-Phenyl-2-(1-piperidinyl)-1-butanone hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22ClNO |
|---|---|
| Molecular Weight | 267.794 |
| Exact Mass | 267.138977 |
| PSA | 20.31000 |
| LogP | 3.87370 |
| InChIKey | HYZFKNOVDJAUNY-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)c1ccccc1)N1CCCCC1.Cl |
| 1-Phenyl-2-(1-piperidinyl)-1-butanone hydrochloride (1:1) |
| 1-Butanone, 1-phenyl-2-(1-piperidinyl)-, hydrochloride (1:1) |