1-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one structure
|
Common Name | 1-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one | ||
|---|---|---|---|---|
| CAS Number | 92736-43-1 | Molecular Weight | 217.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-one |
|---|
| Molecular Formula | C8H6F3N3O |
|---|---|
| Molecular Weight | 217.14800 |
| Exact Mass | 217.04600 |
| PSA | 39.30000 |
| LogP | 1.05180 |
| InChIKey | SUOYECWSCVEJSW-UHFFFAOYSA-N |
| SMILES | Cn1ccc2nc(C(F)(F)F)cc(=O)n21 |
|
~8%
1-methyl-5-(tri... CAS#:92736-43-1 |
| Literature: Balicki, Roman Polish Journal of Chemistry, 1983 , vol. 57, # 4/5/6 p. 413 - 417 |
|
~21%
1-methyl-5-(tri... CAS#:92736-43-1 |
| Literature: Balicki, Roman Polish Journal of Chemistry, 1983 , vol. 57, # 4/5/6 p. 413 - 417 |