1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)
Modify Date: 2026-07-06 09:37:19
![1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) Structure](https://www.chemsrc.com/extcaspic/418/927611-34-5.png)
1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) structure
|
Common Name | 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 927611-34-5 | Molecular Weight | 380.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H28N4O2 |
|---|---|
| Molecular Weight | 380.5 |
| InChIKey | SVRVWDSWLJOVEP-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NC(=O)CN2CCCN(Cc3ccccc3)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)? |
| A: The English name of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) is 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl). |
| Q: What is the SMILES notation of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)? |
| A: SMILES notation of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) is CC(=O)Nc1ccc(NC(=O)CN2CCCN(Cc3ccccc3)CC2)cc1. |
| Q: What is the Chinese name of 927611-34-5? |
| A: Chinese name of 927611-34-5 is 927611-34-5. |
| Q: What is the CAS number of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)? |
| A: CAS number of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) is 927611-34-5. |
| Q: What is the InChIKey of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)? |
| A: InChIKey of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) is SVRVWDSWLJOVEP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)? |
| A: Molecular weight of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) is 380.5. |
| Q: What is the molecular formula of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl)? |
| A: Molecular formula of 1H-1,4-Diazepine-1-acetamide, N-[4-(acetylamino)phenyl]hexahydro-4-(phenylmethyl) is C22H28N4O2. |