5-hydroxy-1-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione structure
|
Common Name | 5-hydroxy-1-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 92764-15-3 | Molecular Weight | 236.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-hydroxy-1-[(3-methoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|
| Molecular Formula | C11H12N2O4 |
|---|---|
| Molecular Weight | 236.22400 |
| Exact Mass | 236.08000 |
| PSA | 82.36000 |
| LogP | 0.27920 |
| InChIKey | XLZZVWYRXGKQDP-UHFFFAOYSA-N |
| SMILES | COc1cccc(CN2C(=O)NC(=O)C2O)c1 |
|
~34%
5-hydroxy-1-[(3... CAS#:92764-15-3 |
| Literature: Liao, Zeng-Kun; Kohn, Harold Journal of Organic Chemistry, 1984 , vol. 49, # 24 p. 4745 - 4752 |
|
~%
5-hydroxy-1-[(3... CAS#:92764-15-3 |
| Literature: Liao, Zeng-Kun; Kohn, Harold Journal of Organic Chemistry, 1984 , vol. 49, # 24 p. 4745 - 4752 |