2-Amino-6-fluoro-4-nitrophenol structure
|
Common Name | 2-Amino-6-fluoro-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 928118-13-2 | Molecular Weight | 172.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-6-fluoro-4-nitrophenol |
|---|
| Molecular Formula | C6H5FN2O3 |
|---|---|
| Molecular Weight | 172.11400 |
| Exact Mass | 172.02800 |
| PSA | 92.07000 |
| LogP | 2.12610 |
| InChIKey | IEUSTEIALPMDEF-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])cc(F)c1O |
| HS Code | 2922299090 |
|---|
|
~95%
2-Amino-6-fluor... CAS#:928118-13-2 |
| Literature: Schering Corporation and Pharmacopeia Drug Discovery, Inc. Patent: US2007/93477 A1, 2007 ; Location in patent: Page/Page column 31-32 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |