bis(3-oxobutan-2-yl) naphthalene-2,6-dicarbodithioate structure
|
Common Name | bis(3-oxobutan-2-yl) naphthalene-2,6-dicarbodithioate | ||
|---|---|---|---|---|
| CAS Number | 92827-64-0 | Molecular Weight | 420.63200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20O2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(3-oxobutan-2-yl) naphthalene-2,6-dicarbodithioate |
|---|
| Molecular Formula | C20H20O2S4 |
|---|---|
| Molecular Weight | 420.63200 |
| Exact Mass | 420.03500 |
| PSA | 148.92000 |
| LogP | 5.61220 |
| InChIKey | ISBHGHPBDDOXFR-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)SC(=S)c1ccc2cc(C(=S)SC(C)C(C)=O)ccc2c1 |
|
~49%
bis(3-oxobutan-... CAS#:92827-64-0 |
| Literature: Bryce, Martin R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1675 - 1680 |
|
~%
bis(3-oxobutan-... CAS#:92827-64-0 |
| Literature: Chen, Shuh-Chung; LeGoff, Eugene Heterocycles, 1984 , vol. 22, # 9 p. 2065 - 2070 |