2-phenylmethoxy-4-propan-2-ylcyclohepta-2,4,6-trien-1-one structure
|
Common Name | 2-phenylmethoxy-4-propan-2-ylcyclohepta-2,4,6-trien-1-one | ||
|---|---|---|---|---|
| CAS Number | 92832-19-4 | Molecular Weight | 254.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenylmethoxy-4-propan-2-ylcyclohepta-2,4,6-trien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32400 |
| Exact Mass | 254.13100 |
| PSA | 26.30000 |
| LogP | 3.74920 |
| InChIKey | DLUPDLMDNGYDKA-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(=O)c(OCc2ccccc2)c1 |
|
~%
2-phenylmethoxy... CAS#:92832-19-4 |
| Literature: Yamato, Masatoshi; Hashigaki, Kuniko; Kokubu, Nobuhiko; Nakato, Yukari Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 1301 - 1304 |
| 2-benzyloxy-4-isopropyltropone |