6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonyl chloride structure
|
Common Name | 6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 928324-59-8 | Molecular Weight | 280.052 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 315.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl2F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3±27.9 °C | |
| Name | 6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.0±42.0 °C at 760 mmHg |
| Molecular Formula | C6H2Cl2F3NO2S |
| Molecular Weight | 280.052 |
| Flash Point | 144.3±27.9 °C |
| Exact Mass | 278.913544 |
| PSA | 55.41000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | UUVXRPZDCPBGQS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cnc(Cl)c(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyridinesulfonyl chloride, 6-chloro-5-(trifluoromethyl)- |
| 6-Chloro-5-(trifluoromethyl)-3-pyridinesulfonyl chloride |