5-chlorotricyclo[2.2.1.0~2,6~]hept-3-yl phenyl sulfone structure
|
Common Name | 5-chlorotricyclo[2.2.1.0~2,6~]hept-3-yl phenyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 92849-69-9 | Molecular Weight | 268.75900 | |
| Density | 1.46g/cm3 | Boiling Point | 460.9ºC at 760 mmHg | |
| Molecular Formula | C13H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | 3-(benzenesulfonyl)-5-chloro-2,3,4,5,6,7-hexahydro-1H-tricyclo[2.2.1.02,6]heptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 460.9ºC at 760 mmHg |
| Molecular Formula | C13H13ClO2S |
| Molecular Weight | 268.75900 |
| Flash Point | 232.5ºC |
| Exact Mass | 268.03200 |
| PSA | 42.52000 |
| LogP | 3.41280 |
| Index of Refraction | 1.645 |
| InChIKey | PTGDUGPVEWYOLE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C1C2CC3C(C2Cl)C31 |
|
~%
5-chlorotricycl... CAS#:92849-69-9 |
| Literature: Christol,S.J.; Davies,D.I. Journal of Organic Chemistry, 1964 , vol. 29, p. 1282 - 1284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Chlor-3-phenylsulfon-tricyclo<2.2.1.02,6>heptan |
| 5-Chlor-3-nortricyclyl-phenylsulfon |
| 3-chloro-5-(phenylsulfonyl)tricyclo[2.2.1.02,6]heptane |