Acetophenone,2-amino-6-methyl-2-phenyl- (7CI) structure
|
Common Name | Acetophenone,2-amino-6-methyl-2-phenyl- (7CI) | ||
|---|---|---|---|---|
| CAS Number | 92850-21-0 | Molecular Weight | 225.28600 | |
| Density | 1.113±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 378.5±30.0 °C (760 mmHg) | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Acetophenone, 2-amino-6'-methyl-2-phenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 378.5±30.0 °C (760 mmHg) |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Exact Mass | 225.11500 |
| PSA | 43.09000 |
| LogP | 3.57800 |
| InChIKey | LXFYXRHIHOSGGM-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(N)C(=O)c1ccccc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| acetophenone,2-amino-6-methyl-2-phenyl- |