4-(3,4-DIMETHYL-QUINOLIN-8-YLAMINO)-BUTAN-2-ONE structure
|
Common Name | 4-(3,4-DIMETHYL-QUINOLIN-8-YLAMINO)-BUTAN-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 92869-89-1 | Molecular Weight | 242.31600 | |
| Density | 1.124g/cm3 | Boiling Point | 445.4ºC at 760 mmHg | |
| Molecular Formula | C15H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.2ºC | |
| Name | 4-[(3,4-dimethylquinolin-8-yl)amino]butan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 445.4ºC at 760 mmHg |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.31600 |
| Flash Point | 223.2ºC |
| Exact Mass | 242.14200 |
| PSA | 41.99000 |
| LogP | 3.31560 |
| Index of Refraction | 1.616 |
| InChIKey | IISIOOXSWPOTQG-UHFFFAOYSA-N |
| SMILES | CC(=O)CCNc1cccc2c(C)c(C)cnc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3,4-DIMETHYL-(QUINOLIN-8-YL)AMINO)-BUTAN-2-ONE |
| N-(3,4-Dimethyl-chinolyl-(8))-4-amino-butanon-(2) |