Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate
Modify Date: 2026-08-06 20:03:37
Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate structure
|
Common Name | Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 92874-73-2 | Molecular Weight | 367.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14ClNO5S |
|---|---|
| Molecular Weight | 367.8 |
| InChIKey | UTRFXDOOJNYVFB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1C(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate? |
| A: CAS number of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate is 92874-73-2. |
| Q: What is the Chinese name of 92874-73-2? |
| A: Chinese name of 92874-73-2 is 92874-73-2. |
| Q: What is the SMILES notation of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate? |
| A: SMILES notation of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate is CCOC(=O)c1ccccc1C(=O)c1ccc(Cl)c(S(N)(=O)=O)c1. |
| Q: What is the English name of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate? |
| A: The English name of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate is Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate. |
| Q: What is the molecular formula of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate? |
| A: Molecular formula of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate is C16H14ClNO5S. |
| Q: What is the molecular weight of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate? |
| A: Molecular weight of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate is 367.8. |
| Q: What is the InChIKey of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate? |
| A: InChIKey of Ethyl 2-(4-chloro-3-sulfamoylbenzoyl)benzoate is UTRFXDOOJNYVFB-UHFFFAOYSA-N. |