1-(5-Fluoro-2,4-dinitrophenyl)-4-methylpiperazine structure
|
Common Name | 1-(5-Fluoro-2,4-dinitrophenyl)-4-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 928830-73-3 | Molecular Weight | 284.244 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 447.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H13FN4O4 | Melting Point | 115ºC | |
| MSDS | N/A | Flash Point | 224.7±28.7 °C | |
| Name | 1-(5-Fluoro-2,4-dinitrophenyl)-4-methylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.9±45.0 °C at 760 mmHg |
| Melting Point | 115ºC |
| Molecular Formula | C11H13FN4O4 |
| Molecular Weight | 284.244 |
| Flash Point | 224.7±28.7 °C |
| Exact Mass | 284.092072 |
| PSA | 98.12000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | SSBAFRIGYXRBRK-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| Storage condition | 2-8°C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Piperazine, 1-(5-fluoro-2,4-dinitrophenyl)-4-methyl- |
| 1-(5-Fluoro-2,4-dinitrophenyl)-4-methylpiperazine |