Chemotactic Domain of Elastin structure
|
Common Name | Chemotactic Domain of Elastin | ||
|---|---|---|---|---|
| CAS Number | 92899-39-3 | Molecular Weight | 498.57300 | |
| Density | 1.245 g/cm3 | Boiling Point | 922.3ºC at 760 mmHg | |
| Molecular Formula | C22H38N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 511.6ºC | |
Use of Chemotactic Domain of ElastinChemotactic Domain of Elastin is an elastin-derived peptide with chemotactic effects on certain tumor cells, such as M27 tumor cells. Chemotactic Domain of Elastin can be used in cancer research[1]. |
| Name | Chemotactic Domain of Elastin |
|---|---|
| Synonym | More Synonyms |
| Description | Chemotactic Domain of Elastin is an elastin-derived peptide with chemotactic effects on certain tumor cells, such as M27 tumor cells. Chemotactic Domain of Elastin can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.245 g/cm3 |
|---|---|
| Boiling Point | 922.3ºC at 760 mmHg |
| Molecular Formula | C22H38N6O7 |
| Molecular Weight | 498.57300 |
| Flash Point | 511.6ºC |
| Exact Mass | 498.28000 |
| PSA | 200.03000 |
| LogP | 0.12500 |
| Index of Refraction | 1.535 |
| InChIKey | RLCSROTYKMPBDL-USJZOSNVSA-N |
| SMILES | CC(NC(=O)C(NC(=O)CNC(=O)C(N)C(C)C)C(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O |
| H-VAL-GLY-VAL-ALA-PRO-GLY-OH |
| valyl-glycyl-valyl-alanyl-prolyl-glycine |
| ChemostaticdomainofElastin |
| VAL-GLY-VAL-ALA-PRO-GLY |