1,1-diethyl-3-(3-nitrophenyl)urea structure
|
Common Name | 1,1-diethyl-3-(3-nitrophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 92902-51-7 | Molecular Weight | 237.25500 | |
| Density | 1.241g/cm3 | Boiling Point | 416.7ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | 1,1-diethyl-3-(3-nitrophenyl)urea |
|---|
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 416.7ºC at 760 mmHg |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.25500 |
| Flash Point | 205.8ºC |
| Exact Mass | 237.11100 |
| PSA | 78.16000 |
| LogP | 3.06470 |
| Index of Refraction | 1.592 |
| InChIKey | MGLQHMGZCTZIJT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
|
~70%
1,1-diethyl-3-(... CAS#:92902-51-7 |
| Literature: Zielinski, Wojciech; Kudelko, Agnieszka; Holt, Elizabeth M. Heterocycles, 1998 , vol. 48, # 2 p. 319 - 328 |
|
~%
1,1-diethyl-3-(... CAS#:92902-51-7 |
| Literature: Ozaki; Nagoya Bulletin of the Chemical Society of Japan, 1957 , vol. 30, p. 444,448 |
|
~%
1,1-diethyl-3-(... CAS#:92902-51-7 |
| Literature: van Hoogstraten Recueil des Travaux Chimiques des Pays-Bas, 1932 , vol. 51, p. 414,430 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |